C20H23N3OS — CID 100649896
1-[3-(2-oxopyrrolidin-1-yl)phenyl]-3-[(1R)-1-phenylpropyl]thiourea (PubChem CID 100649896) has the molecular formula C20H23N3OS and a molecular weight of 353.49 g/mol. Its IUPAC name is 1-[3-(2-oxopyrrolidin-1-yl)phenyl]-3-[(1R)-1-phenylpropyl]thiourea.
| Compound Name | 1-[3-(2-oxopyrrolidin-1-yl)phenyl]-3-[(1R)-1-phenylpropyl]thiourea |
|---|---|
| PubChem CID | 100649896 |
| Molecular Formula | C20H23N3OS |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | 1-[3-(2-oxopyrrolidin-1-yl)phenyl]-3-[(1R)-1-phenylpropyl]thiourea |
| SMILES | CC[C@@H](NC(=S)Nc1cccc(N2CCCC2=O)c1)c1ccccc1 |
| InChI | InChI=1S/C20H23N3OS/c1-2-18(15-8-4-3-5-9-15)22-20(25)21-16-10-6-11-17(14-16)23-13-7-12-19(23)24/h3-6,8-11,14,18H,2,7,12-13H2,1H3,(H2,21,22,25)/t18-/m1/s1 |
| InChIKey | UDBVZBVNNVBJRK-GOSISDBHSA-N |
| XLogP | 4.25 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|