C22H27N3OS — CID 100654739
1-[(1S)-3-methyl-1-phenylbutyl]-3-[4-(2-oxopyrrolidin-1-yl)phenyl]thiourea (PubChem CID 100654739) has the molecular formula C22H27N3OS and a molecular weight of 381.55 g/mol. Its IUPAC name is 1-[(1S)-3-methyl-1-phenylbutyl]-3-[4-(2-oxopyrrolidin-1-yl)phenyl]thiourea.
| Compound Name | 1-[(1S)-3-methyl-1-phenylbutyl]-3-[4-(2-oxopyrrolidin-1-yl)phenyl]thiourea |
|---|---|
| PubChem CID | 100654739 |
| Molecular Formula | C22H27N3OS |
| Molecular Weight | 381.55 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | 1-[(1S)-3-methyl-1-phenylbutyl]-3-[4-(2-oxopyrrolidin-1-yl)phenyl]thiourea |
| SMILES | CC(C)C[C@H](NC(=S)Nc1ccc(N2CCCC2=O)cc1)c1ccccc1 |
| InChI | InChI=1S/C22H27N3OS/c1-16(2)15-20(17-7-4-3-5-8-17)24-22(27)23-18-10-12-19(13-11-18)25-14-6-9-21(25)26/h3-5,7-8,10-13,16,20H,6,9,14-15H2,1-2H3,(H2,23,24,27)/t20-/m0/s1 |
| InChIKey | BPAXJVZTKQJHNW-FQEVSTJZSA-N |
| XLogP | 4.89 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.55 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|