C24H30N4OS — CID 100715728
1-[4-(2-oxopyrrolidin-1-yl)phenyl]-3-[(1S)-1-(4-piperidin-1-ylphenyl)ethyl]thiourea (PubChem CID 100715728) has the molecular formula C24H30N4OS and a molecular weight of 422.60 g/mol. Its IUPAC name is 1-[4-(2-oxopyrrolidin-1-yl)phenyl]-3-[(1S)-1-(4-piperidin-1-ylphenyl)ethyl]thiourea.
| Compound Name | 1-[4-(2-oxopyrrolidin-1-yl)phenyl]-3-[(1S)-1-(4-piperidin-1-ylphenyl)ethyl]thiourea |
|---|---|
| PubChem CID | 100715728 |
| Molecular Formula | C24H30N4OS |
| Molecular Weight | 422.60 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | 1-[4-(2-oxopyrrolidin-1-yl)phenyl]-3-[(1S)-1-(4-piperidin-1-ylphenyl)ethyl]thiourea |
| SMILES | C[C@H](NC(=S)Nc1ccc(N2CCCC2=O)cc1)c1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C24H30N4OS/c1-18(19-7-11-21(12-8-19)27-15-3-2-4-16-27)25-24(30)26-20-9-13-22(14-10-20)28-17-5-6-23(28)29/h7-14,18H,2-6,15-17H2,1H3,(H2,25,26,30)/t18-/m0/s1 |
| InChIKey | JICDWXNBHOZTHM-SFHVURJKSA-N |
| XLogP | 4.85 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.60 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|