C25H32N4OS — CID 100717504
1-[(1S)-1-[4-[(3R)-3-methylpiperidin-1-yl]phenyl]ethyl]-3-[3-(2-oxopyrrolidin-1-yl)phenyl]thiourea (PubChem CID 100717504) has the molecular formula C25H32N4OS and a molecular weight of 436.63 g/mol. Its IUPAC name is 1-[(1S)-1-[4-[(3R)-3-methylpiperidin-1-yl]phenyl]ethyl]-3-[3-(2-oxopyrrolidin-1-yl)phenyl]thiourea.
| Compound Name | 1-[(1S)-1-[4-[(3R)-3-methylpiperidin-1-yl]phenyl]ethyl]-3-[3-(2-oxopyrrolidin-1-yl)phenyl]thiourea |
|---|---|
| PubChem CID | 100717504 |
| Molecular Formula | C25H32N4OS |
| Molecular Weight | 436.63 g/mol |
| Exact Mass | 436.23 |
| IUPAC Name | 1-[(1S)-1-[4-[(3R)-3-methylpiperidin-1-yl]phenyl]ethyl]-3-[3-(2-oxopyrrolidin-1-yl)phenyl]thiourea |
| SMILES | C[C@@H]1CCCN(c2ccc([C@H](C)NC(=S)Nc3cccc(N4CCCC4=O)c3)cc2)C1 |
| InChI | InChI=1S/C25H32N4OS/c1-18-6-4-14-28(17-18)22-12-10-20(11-13-22)19(2)26-25(31)27-21-7-3-8-23(16-21)29-15-5-9-24(29)30/h3,7-8,10-13,16,18-19H,4-6,9,14-15,17H2,1-2H3,(H2,26,27,31)/t18-,19+/m1/s1 |
| InChIKey | DWIPCJOVSVZERK-MOPGFXCFSA-N |
| XLogP | 5.10 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.63 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|