C23H31N3S — CID 125049107
1-(3,4-dimethylphenyl)-3-[(1R)-1-[4-[(3S)-3-methylpiperidin-1-yl]phenyl]ethyl]thiourea (PubChem CID 125049107) has the molecular formula C23H31N3S and a molecular weight of 381.59 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-3-[(1R)-1-[4-[(3S)-3-methylpiperidin-1-yl]phenyl]ethyl]thiourea.
| Compound Name | 1-(3,4-dimethylphenyl)-3-[(1R)-1-[4-[(3S)-3-methylpiperidin-1-yl]phenyl]ethyl]thiourea |
|---|---|
| PubChem CID | 125049107 |
| Molecular Formula | C23H31N3S |
| Molecular Weight | 381.59 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-3-[(1R)-1-[4-[(3S)-3-methylpiperidin-1-yl]phenyl]ethyl]thiourea |
| SMILES | Cc1ccc(NC(=S)N[C@H](C)c2ccc(N3CCC[C@H](C)C3)cc2)cc1C |
| InChI | InChI=1S/C23H31N3S/c1-16-6-5-13-26(15-16)22-11-8-20(9-12-22)19(4)24-23(27)25-21-10-7-17(2)18(3)14-21/h7-12,14,16,19H,5-6,13,15H2,1-4H3,(H2,24,25,27)/t16-,19+/m0/s1 |
| InChIKey | TVQGHUNIQXODGD-QFBILLFUSA-N |
| XLogP | 5.59 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.59 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|