C22H28ClN3S — CID 100716721
1-(3-chloro-4-methylphenyl)-3-[(1R)-1-[4-[(3R)-3-methylpiperidin-1-yl]phenyl]ethyl]thiourea (PubChem CID 100716721) has the molecular formula C22H28ClN3S and a molecular weight of 402.01 g/mol. Its IUPAC name is 1-(3-chloro-4-methylphenyl)-3-[(1R)-1-[4-[(3R)-3-methylpiperidin-1-yl]phenyl]ethyl]thiourea.
| Compound Name | 1-(3-chloro-4-methylphenyl)-3-[(1R)-1-[4-[(3R)-3-methylpiperidin-1-yl]phenyl]ethyl]thiourea |
|---|---|
| PubChem CID | 100716721 |
| Molecular Formula | C22H28ClN3S |
| Molecular Weight | 402.01 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | 1-(3-chloro-4-methylphenyl)-3-[(1R)-1-[4-[(3R)-3-methylpiperidin-1-yl]phenyl]ethyl]thiourea |
| SMILES | Cc1ccc(NC(=S)N[C@H](C)c2ccc(N3CCC[C@@H](C)C3)cc2)cc1Cl |
| InChI | InChI=1S/C22H28ClN3S/c1-15-5-4-12-26(14-15)20-10-7-18(8-11-20)17(3)24-22(27)25-19-9-6-16(2)21(23)13-19/h6-11,13,15,17H,4-5,12,14H2,1-3H3,(H2,24,25,27)/t15-,17-/m1/s1 |
| InChIKey | JNJVQOUNWKEVHP-NVXWUHKLSA-N |
| XLogP | 5.93 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.01 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|