C23H28ClN3O2S — CID 133155064
methyl 2-chloro-5-[1-[4-(3-methylpiperidin-1-yl)phenyl]ethylcarbamothioylamino]benzoate (PubChem CID 133155064) has the molecular formula C23H28ClN3O2S and a molecular weight of 446.02 g/mol. Its IUPAC name is methyl 2-chloro-5-[1-[4-(3-methylpiperidin-1-yl)phenyl]ethylcarbamothioylamino]benzoate.
| Compound Name | methyl 2-chloro-5-[1-[4-(3-methylpiperidin-1-yl)phenyl]ethylcarbamothioylamino]benzoate |
|---|---|
| PubChem CID | 133155064 |
| Molecular Formula | C23H28ClN3O2S |
| Molecular Weight | 446.02 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | methyl 2-chloro-5-[1-[4-(3-methylpiperidin-1-yl)phenyl]ethylcarbamothioylamino]benzoate |
| SMILES | COC(=O)c1cc(NC(=S)NC(C)c2ccc(N3CCCC(C)C3)cc2)ccc1Cl |
| InChI | InChI=1S/C23H28ClN3O2S/c1-15-5-4-12-27(14-15)19-9-6-17(7-10-19)16(2)25-23(30)26-18-8-11-21(24)20(13-18)22(28)29-3/h6-11,13,15-16H,4-5,12,14H2,1-3H3,(H2,25,26,30) |
| InChIKey | MBZSJKNJVSWNHE-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.02 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|