C21H25BrClN3S — CID 125048165
1-(4-bromo-3-chlorophenyl)-3-[(1S)-1-[4-[(3S)-3-methylpiperidin-1-yl]phenyl]ethyl]thiourea (PubChem CID 125048165) has the molecular formula C21H25BrClN3S and a molecular weight of 466.88 g/mol. Its IUPAC name is 1-(4-bromo-3-chlorophenyl)-3-[(1S)-1-[4-[(3S)-3-methylpiperidin-1-yl]phenyl]ethyl]thiourea.
| Compound Name | 1-(4-bromo-3-chlorophenyl)-3-[(1S)-1-[4-[(3S)-3-methylpiperidin-1-yl]phenyl]ethyl]thiourea |
|---|---|
| PubChem CID | 125048165 |
| Molecular Formula | C21H25BrClN3S |
| Molecular Weight | 466.88 g/mol |
| Exact Mass | 465.06 |
| IUPAC Name | 1-(4-bromo-3-chlorophenyl)-3-[(1S)-1-[4-[(3S)-3-methylpiperidin-1-yl]phenyl]ethyl]thiourea |
| SMILES | C[C@H]1CCCN(c2ccc([C@H](C)NC(=S)Nc3ccc(Br)c(Cl)c3)cc2)C1 |
| InChI | InChI=1S/C21H25BrClN3S/c1-14-4-3-11-26(13-14)18-8-5-16(6-9-18)15(2)24-21(27)25-17-7-10-19(22)20(23)12-17/h5-10,12,14-15H,3-4,11,13H2,1-2H3,(H2,24,25,27)/t14-,15-/m0/s1 |
| InChIKey | HRIJWSUGVKTIEN-GJZGRUSLSA-N |
| XLogP | 6.39 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.88 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|