C21H26BrN3S — CID 125048200
1-(4-bromophenyl)-3-[(1R)-1-[4-[(3S)-3-methylpiperidin-1-yl]phenyl]ethyl]thiourea (PubChem CID 125048200) has the molecular formula C21H26BrN3S and a molecular weight of 432.43 g/mol. Its IUPAC name is 1-(4-bromophenyl)-3-[(1R)-1-[4-[(3S)-3-methylpiperidin-1-yl]phenyl]ethyl]thiourea.
| Compound Name | 1-(4-bromophenyl)-3-[(1R)-1-[4-[(3S)-3-methylpiperidin-1-yl]phenyl]ethyl]thiourea |
|---|---|
| PubChem CID | 125048200 |
| Molecular Formula | C21H26BrN3S |
| Molecular Weight | 432.43 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | 1-(4-bromophenyl)-3-[(1R)-1-[4-[(3S)-3-methylpiperidin-1-yl]phenyl]ethyl]thiourea |
| SMILES | C[C@H]1CCCN(c2ccc([C@@H](C)NC(=S)Nc3ccc(Br)cc3)cc2)C1 |
| InChI | InChI=1S/C21H26BrN3S/c1-15-4-3-13-25(14-15)20-11-5-17(6-12-20)16(2)23-21(26)24-19-9-7-18(22)8-10-19/h5-12,15-16H,3-4,13-14H2,1-2H3,(H2,23,24,26)/t15-,16+/m0/s1 |
| InChIKey | JJDXLSQNYLAILV-JKSUJKDBSA-N |
| XLogP | 5.73 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.43 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|