C28H33N3S2 — CID 100716836
1-[(1R)-1-[4-[(3R)-3-methylpiperidin-1-yl]phenyl]ethyl]-3-[4-(phenylsulfanylmethyl)phenyl]thiourea (PubChem CID 100716836) has the molecular formula C28H33N3S2 and a molecular weight of 475.73 g/mol. Its IUPAC name is 1-[(1R)-1-[4-[(3R)-3-methylpiperidin-1-yl]phenyl]ethyl]-3-[4-(phenylsulfanylmethyl)phenyl]thiourea.
| Compound Name | 1-[(1R)-1-[4-[(3R)-3-methylpiperidin-1-yl]phenyl]ethyl]-3-[4-(phenylsulfanylmethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 100716836 |
| Molecular Formula | C28H33N3S2 |
| Molecular Weight | 475.73 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | 1-[(1R)-1-[4-[(3R)-3-methylpiperidin-1-yl]phenyl]ethyl]-3-[4-(phenylsulfanylmethyl)phenyl]thiourea |
| SMILES | C[C@@H]1CCCN(c2ccc([C@@H](C)NC(=S)Nc3ccc(CSc4ccccc4)cc3)cc2)C1 |
| InChI | InChI=1S/C28H33N3S2/c1-21-7-6-18-31(19-21)26-16-12-24(13-17-26)22(2)29-28(32)30-25-14-10-23(11-15-25)20-33-27-8-4-3-5-9-27/h3-5,8-17,21-22H,6-7,18-20H2,1-2H3,(H2,29,30,32)/t21-,22-/m1/s1 |
| InChIKey | SOYADIMBGAWTGA-FGZHOGPDSA-N |
| XLogP | 7.26 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.73 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|