C22H21FN2S2 — CID 100646112
1-[(1S)-1-(4-fluorophenyl)ethyl]-3-[4-(phenylsulfanylmethyl)phenyl]thiourea (PubChem CID 100646112) has the molecular formula C22H21FN2S2 and a molecular weight of 396.56 g/mol. Its IUPAC name is 1-[(1S)-1-(4-fluorophenyl)ethyl]-3-[4-(phenylsulfanylmethyl)phenyl]thiourea.
| Compound Name | 1-[(1S)-1-(4-fluorophenyl)ethyl]-3-[4-(phenylsulfanylmethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 100646112 |
| Molecular Formula | C22H21FN2S2 |
| Molecular Weight | 396.56 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | 1-[(1S)-1-(4-fluorophenyl)ethyl]-3-[4-(phenylsulfanylmethyl)phenyl]thiourea |
| SMILES | C[C@H](NC(=S)Nc1ccc(CSc2ccccc2)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H21FN2S2/c1-16(18-9-11-19(23)12-10-18)24-22(26)25-20-13-7-17(8-14-20)15-27-21-5-3-2-4-6-21/h2-14,16H,15H2,1H3,(H2,24,25,26)/t16-/m0/s1 |
| InChIKey | DXYOBAIHNCINRX-INIZCTEOSA-N |
| XLogP | 6.17 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.56 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|