C24H26N2S2 — CID 100662034
1-[(2S)-4-phenylbutan-2-yl]-3-[4-(phenylsulfanylmethyl)phenyl]thiourea (PubChem CID 100662034) has the molecular formula C24H26N2S2 and a molecular weight of 406.62 g/mol. Its IUPAC name is 1-[(2S)-4-phenylbutan-2-yl]-3-[4-(phenylsulfanylmethyl)phenyl]thiourea.
| Compound Name | 1-[(2S)-4-phenylbutan-2-yl]-3-[4-(phenylsulfanylmethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 100662034 |
| Molecular Formula | C24H26N2S2 |
| Molecular Weight | 406.62 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | 1-[(2S)-4-phenylbutan-2-yl]-3-[4-(phenylsulfanylmethyl)phenyl]thiourea |
| SMILES | C[C@@H](CCc1ccccc1)NC(=S)Nc1ccc(CSc2ccccc2)cc1 |
| InChI | InChI=1S/C24H26N2S2/c1-19(12-13-20-8-4-2-5-9-20)25-24(27)26-22-16-14-21(15-17-22)18-28-23-10-6-3-7-11-23/h2-11,14-17,19H,12-13,18H2,1H3,(H2,25,26,27)/t19-/m0/s1 |
| InChIKey | NRCHPVBHEFICKR-IBGZPJMESA-N |
| XLogP | 6.29 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.62 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|