C21H26N2S2 — CID 100768320
1-(1-methylcyclohexyl)-3-[4-(phenylsulfanylmethyl)phenyl]thiourea (PubChem CID 100768320) has the molecular formula C21H26N2S2 and a molecular weight of 370.59 g/mol. Its IUPAC name is 1-(1-methylcyclohexyl)-3-[4-(phenylsulfanylmethyl)phenyl]thiourea.
| Compound Name | 1-(1-methylcyclohexyl)-3-[4-(phenylsulfanylmethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 100768320 |
| Molecular Formula | C21H26N2S2 |
| Molecular Weight | 370.59 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 1-(1-methylcyclohexyl)-3-[4-(phenylsulfanylmethyl)phenyl]thiourea |
| SMILES | CC1(NC(=S)Nc2ccc(CSc3ccccc3)cc2)CCCCC1 |
| InChI | InChI=1S/C21H26N2S2/c1-21(14-6-3-7-15-21)23-20(24)22-18-12-10-17(11-13-18)16-25-19-8-4-2-5-9-19/h2,4-5,8-13H,3,6-7,14-16H2,1H3,(H2,22,23,24) |
| InChIKey | BLEIVAUAPZUJGK-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.59 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|