C23H31N3S2 — CID 100616574
1-[3-(azepan-1-yl)propyl]-3-[4-(phenylsulfanylmethyl)phenyl]thiourea (PubChem CID 100616574) has the molecular formula C23H31N3S2 and a molecular weight of 413.66 g/mol. Its IUPAC name is 1-[3-(azepan-1-yl)propyl]-3-[4-(phenylsulfanylmethyl)phenyl]thiourea.
| Compound Name | 1-[3-(azepan-1-yl)propyl]-3-[4-(phenylsulfanylmethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 100616574 |
| Molecular Formula | C23H31N3S2 |
| Molecular Weight | 413.66 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | 1-[3-(azepan-1-yl)propyl]-3-[4-(phenylsulfanylmethyl)phenyl]thiourea |
| SMILES | S=C(NCCCN1CCCCCC1)Nc1ccc(CSc2ccccc2)cc1 |
| InChI | InChI=1S/C23H31N3S2/c27-23(24-15-8-18-26-16-6-1-2-7-17-26)25-21-13-11-20(12-14-21)19-28-22-9-4-3-5-10-22/h3-5,9-14H,1-2,6-8,15-19H2,(H2,24,25,27) |
| InChIKey | TWEZLNCMISFESX-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.66 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|