C17H27N3S — CID 94876840
1-[3-(azepan-1-yl)propyl]-3-(4-methylphenyl)thiourea (PubChem CID 94876840) has the molecular formula C17H27N3S and a molecular weight of 305.49 g/mol. Its IUPAC name is 1-[3-(azepan-1-yl)propyl]-3-(4-methylphenyl)thiourea.
| Compound Name | 1-[3-(azepan-1-yl)propyl]-3-(4-methylphenyl)thiourea |
|---|---|
| PubChem CID | 94876840 |
| Molecular Formula | C17H27N3S |
| Molecular Weight | 305.49 g/mol |
| Exact Mass | 305.19 |
| IUPAC Name | 1-[3-(azepan-1-yl)propyl]-3-(4-methylphenyl)thiourea |
| SMILES | Cc1ccc(NC(=S)NCCCN2CCCCCC2)cc1 |
| InChI | InChI=1S/C17H27N3S/c1-15-7-9-16(10-8-15)19-17(21)18-11-6-14-20-12-4-2-3-5-13-20/h7-10H,2-6,11-14H2,1H3,(H2,18,19,21) |
| InChIKey | AGTARFMCLKUNCV-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.49 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|