C19H23N3S — CID 100678157
1-[3-(2,3-dihydroindol-1-yl)propyl]-3-(4-methylphenyl)thiourea (PubChem CID 100678157) has the molecular formula C19H23N3S and a molecular weight of 325.48 g/mol. Its IUPAC name is 1-[3-(2,3-dihydroindol-1-yl)propyl]-3-(4-methylphenyl)thiourea.
| Compound Name | 1-[3-(2,3-dihydroindol-1-yl)propyl]-3-(4-methylphenyl)thiourea |
|---|---|
| PubChem CID | 100678157 |
| Molecular Formula | C19H23N3S |
| Molecular Weight | 325.48 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | 1-[3-(2,3-dihydroindol-1-yl)propyl]-3-(4-methylphenyl)thiourea |
| SMILES | Cc1ccc(NC(=S)NCCCN2CCc3ccccc32)cc1 |
| InChI | InChI=1S/C19H23N3S/c1-15-7-9-17(10-8-15)21-19(23)20-12-4-13-22-14-11-16-5-2-3-6-18(16)22/h2-3,5-10H,4,11-14H2,1H3,(H2,20,21,23) |
| InChIKey | DBRPBRLLBOQLRW-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.48 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_urea_A(12)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|