C19H24N4S — CID 100742318
1-[3-(3,4-dihydro-2H-quinolin-1-yl)propyl]-3-(6-methyl-2-pyridinyl)thiourea (PubChem CID 100742318) has the molecular formula C19H24N4S and a molecular weight of 340.50 g/mol. Its IUPAC name is 1-[3-(3,4-dihydro-2H-quinolin-1-yl)propyl]-3-(6-methyl-2-pyridinyl)thiourea.
| Compound Name | 1-[3-(3,4-dihydro-2H-quinolin-1-yl)propyl]-3-(6-methyl-2-pyridinyl)thiourea |
|---|---|
| PubChem CID | 100742318 |
| Molecular Formula | C19H24N4S |
| Molecular Weight | 340.50 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | 1-[3-(3,4-dihydro-2H-quinolin-1-yl)propyl]-3-(6-methyl-2-pyridinyl)thiourea |
| SMILES | Cc1cccc(NC(=S)NCCCN2CCCc3ccccc32)n1 |
| InChI | InChI=1S/C19H24N4S/c1-15-7-4-11-18(21-15)22-19(24)20-12-6-14-23-13-5-9-16-8-2-3-10-17(16)23/h2-4,7-8,10-11H,5-6,9,12-14H2,1H3,(H2,20,21,22,24) |
| InChIKey | XYKULRQGLPDWCR-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 40.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.50 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|