C21H27N3O — CID 23609343
1-[3-(3,4-dihydro-2H-quinolin-1-yl)propyl]-3-(3,5-dimethylphenyl)urea (PubChem CID 23609343) has the molecular formula C21H27N3O and a molecular weight of 337.47 g/mol. Its IUPAC name is 1-[3-(3,4-dihydro-2H-quinolin-1-yl)propyl]-3-(3,5-dimethylphenyl)urea.
| Compound Name | 1-[3-(3,4-dihydro-2H-quinolin-1-yl)propyl]-3-(3,5-dimethylphenyl)urea |
|---|---|
| PubChem CID | 23609343 |
| Molecular Formula | C21H27N3O |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.22 |
| IUPAC Name | 1-[3-(3,4-dihydro-2H-quinolin-1-yl)propyl]-3-(3,5-dimethylphenyl)urea |
| SMILES | Cc1cc(C)cc(NC(=O)NCCCN2CCCc3ccccc32)c1 |
| InChI | InChI=1S/C21H27N3O/c1-16-13-17(2)15-19(14-16)23-21(25)22-10-6-12-24-11-5-8-18-7-3-4-9-20(18)24/h3-4,7,9,13-15H,5-6,8,10-12H2,1-2H3,(H2,22,23,25) |
| InChIKey | HUWYXOKXVZRJAZ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|