C24H32N2O2 — CID 132657155
N-[3-(3,4-dihydro-2H-quinolin-1-yl)propyl]-2-(3,5-dimethylphenoxy)butanamide (PubChem CID 132657155) has the molecular formula C24H32N2O2 and a molecular weight of 380.53 g/mol. Its IUPAC name is N-[3-(3,4-dihydro-2H-quinolin-1-yl)propyl]-2-(3,5-dimethylphenoxy)butanamide.
| Compound Name | N-[3-(3,4-dihydro-2H-quinolin-1-yl)propyl]-2-(3,5-dimethylphenoxy)butanamide |
|---|---|
| PubChem CID | 132657155 |
| Molecular Formula | C24H32N2O2 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.25 |
| IUPAC Name | N-[3-(3,4-dihydro-2H-quinolin-1-yl)propyl]-2-(3,5-dimethylphenoxy)butanamide |
| SMILES | CCC(Oc1cc(C)cc(C)c1)C(=O)NCCCN1CCCc2ccccc21 |
| InChI | InChI=1S/C24H32N2O2/c1-4-23(28-21-16-18(2)15-19(3)17-21)24(27)25-12-8-14-26-13-7-10-20-9-5-6-11-22(20)26/h5-6,9,11,15-17,23H,4,7-8,10,12-14H2,1-3H3,(H,25,27) |
| InChIKey | RUPFVEMNGZSJSL-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|