C20H28N4O3 — CID 51495865
(2R)-N-[3-(3,4-dihydro-2H-quinolin-1-yl)propyl]-2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanamide (PubChem CID 51495865) has the molecular formula C20H28N4O3 and a molecular weight of 372.47 g/mol. Its IUPAC name is (2R)-N-[3-(3,4-dihydro-2H-quinolin-1-yl)propyl]-2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanamide.
| Compound Name | (2R)-N-[3-(3,4-dihydro-2H-quinolin-1-yl)propyl]-2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanamide |
|---|---|
| PubChem CID | 51495865 |
| Molecular Formula | C20H28N4O3 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | (2R)-N-[3-(3,4-dihydro-2H-quinolin-1-yl)propyl]-2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanamide |
| SMILES | C[C@H](C(=O)NCCCN1CCCc2ccccc21)N1C(=O)NC(C)(C)C1=O |
| InChI | InChI=1S/C20H28N4O3/c1-14(24-18(26)20(2,3)22-19(24)27)17(25)21-11-7-13-23-12-6-9-15-8-4-5-10-16(15)23/h4-5,8,10,14H,6-7,9,11-13H2,1-3H3,(H,21,25)(H,22,27)/t14-/m1/s1 |
| InChIKey | OUNDQQYFDZFJHJ-CQSZACIVSA-N |
| XLogP | 1.66 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|