C20H27N5O — CID 131946106
2-amino-N-[3-(3,4-dihydro-2H-quinolin-1-yl)propyl]-6-propan-2-ylpyrimidine-4-carboxamide (PubChem CID 131946106) has the molecular formula C20H27N5O and a molecular weight of 353.47 g/mol. Its IUPAC name is 2-amino-N-[3-(3,4-dihydro-2H-quinolin-1-yl)propyl]-6-propan-2-ylpyrimidine-4-carboxamide.
| Compound Name | 2-amino-N-[3-(3,4-dihydro-2H-quinolin-1-yl)propyl]-6-propan-2-ylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 131946106 |
| Molecular Formula | C20H27N5O |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.22 |
| IUPAC Name | 2-amino-N-[3-(3,4-dihydro-2H-quinolin-1-yl)propyl]-6-propan-2-ylpyrimidine-4-carboxamide |
| SMILES | CC(C)c1cc(C(=O)NCCCN2CCCc3ccccc32)nc(N)n1 |
| InChI | InChI=1S/C20H27N5O/c1-14(2)16-13-17(24-20(21)23-16)19(26)22-10-6-12-25-11-5-8-15-7-3-4-9-18(15)25/h3-4,7,9,13-14H,5-6,8,10-12H2,1-2H3,(H,22,26)(H2,21,23,24) |
| InChIKey | PLCTXBJPKSZADW-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|