C18H21N3O — CID 119851205
3-amino-N-[3-(2,3-dihydroindol-1-yl)propyl]benzamide (PubChem CID 119851205) has the molecular formula C18H21N3O and a molecular weight of 295.39 g/mol. Its IUPAC name is 3-amino-N-[3-(2,3-dihydroindol-1-yl)propyl]benzamide.
| Compound Name | 3-amino-N-[3-(2,3-dihydroindol-1-yl)propyl]benzamide |
|---|---|
| PubChem CID | 119851205 |
| Molecular Formula | C18H21N3O |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | 3-amino-N-[3-(2,3-dihydroindol-1-yl)propyl]benzamide |
| SMILES | Nc1cccc(C(=O)NCCCN2CCc3ccccc32)c1 |
| InChI | InChI=1S/C18H21N3O/c19-16-7-3-6-15(13-16)18(22)20-10-4-11-21-12-9-14-5-1-2-8-17(14)21/h1-3,5-8,13H,4,9-12,19H2,(H,20,22) |
| InChIKey | ZKIFELIJRFNULD-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|