C14H23Cl2N3O — CID 119851222
3-amino-N-[3-(2,3-dihydroindol-1-yl)propyl]propanamide;dihydrochloride (PubChem CID 119851222) has the molecular formula C14H23Cl2N3O and a molecular weight of 320.26 g/mol. Its IUPAC name is 3-amino-N-[3-(2,3-dihydroindol-1-yl)propyl]propanamide;dihydrochloride.
| Compound Name | 3-amino-N-[3-(2,3-dihydroindol-1-yl)propyl]propanamide;dihydrochloride |
|---|---|
| PubChem CID | 119851222 |
| Molecular Formula | C14H23Cl2N3O |
| Molecular Weight | 320.26 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 3-amino-N-[3-(2,3-dihydroindol-1-yl)propyl]propanamide;dihydrochloride |
| SMILES | Cl.Cl.NCCC(=O)NCCCN1CCc2ccccc21 |
| InChI | InChI=1S/C14H21N3O.2ClH/c15-8-6-14(18)16-9-3-10-17-11-7-12-4-1-2-5-13(12)17;;/h1-2,4-5H,3,6-11,15H2,(H,16,18);2*1H |
| InChIKey | VASIOALNMWJZIA-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.26 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|