C19H33Cl2N3O — CID 119851304
7-amino-N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]heptanamide;dihydrochloride (PubChem CID 119851304) has the molecular formula C19H33Cl2N3O and a molecular weight of 390.40 g/mol. Its IUPAC name is 7-amino-N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]heptanamide;dihydrochloride.
| Compound Name | 7-amino-N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]heptanamide;dihydrochloride |
|---|---|
| PubChem CID | 119851304 |
| Molecular Formula | C19H33Cl2N3O |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | 7-amino-N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]heptanamide;dihydrochloride |
| SMILES | Cl.Cl.NCCCCCCC(=O)NCCCN1CCc2ccccc2C1 |
| InChI | InChI=1S/C19H31N3O.2ClH/c20-12-6-2-1-3-10-19(23)21-13-7-14-22-15-11-17-8-4-5-9-18(17)16-22;;/h4-5,8-9H,1-3,6-7,10-16,20H2,(H,21,23);2*1H |
| InChIKey | FUYNOKKQNFYQGE-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|