C13H21ClN2 — CID 68962885
4-(3,4-dihydro-1H-isoquinolin-2-yl)butan-1-amine;hydrochloride (PubChem CID 68962885) has the molecular formula C13H21ClN2 and a molecular weight of 240.78 g/mol. Its IUPAC name is 4-(3,4-dihydro-1H-isoquinolin-2-yl)butan-1-amine;hydrochloride.
| Compound Name | 4-(3,4-dihydro-1H-isoquinolin-2-yl)butan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 68962885 |
| Molecular Formula | C13H21ClN2 |
| Molecular Weight | 240.78 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 4-(3,4-dihydro-1H-isoquinolin-2-yl)butan-1-amine;hydrochloride |
| SMILES | Cl.NCCCCN1CCc2ccccc2C1 |
| InChI | InChI=1S/C13H20N2.ClH/c14-8-3-4-9-15-10-7-12-5-1-2-6-13(12)11-15;/h1-2,5-6H,3-4,7-11,14H2;1H |
| InChIKey | RHPUKENRSQIIDC-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.78 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|