C13H16ClNO — CID 39255656
4-(3,4-dihydro-1H-isoquinolin-2-yl)butanoyl chloride (PubChem CID 39255656) has the molecular formula C13H16ClNO and a molecular weight of 237.73 g/mol. Its IUPAC name is 4-(3,4-dihydro-1H-isoquinolin-2-yl)butanoyl chloride.
| Compound Name | 4-(3,4-dihydro-1H-isoquinolin-2-yl)butanoyl chloride |
|---|---|
| PubChem CID | 39255656 |
| Molecular Formula | C13H16ClNO |
| Molecular Weight | 237.73 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | 4-(3,4-dihydro-1H-isoquinolin-2-yl)butanoyl chloride |
| SMILES | O=C(Cl)CCCN1CCc2ccccc2C1 |
| InChI | InChI=1S/C13H16ClNO/c14-13(16)6-3-8-15-9-7-11-4-1-2-5-12(11)10-15/h1-2,4-5H,3,6-10H2 |
| InChIKey | SCQHGWOIUJIXDK-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.73 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|