methyl 3-(3,4-dihydro-1H-isoquinolin-2-yl)propanoate

C13H17NO2 — CID 10955041

IUPACmethyl 3-(3,4-dihydro-1H-isoquinolin-2-yl)propanoate
SMILESCOC(=O)CCN1CCc2ccccc2C1
InChIInChI=1S/C13H17NO2/c1-16-13(15)7-9-14-8-6-11-4-2-3-5-12(11)10-14/h2-5H,6-10H2,1H3
InChIKeyLGCHTHNCFDGWBW-UHFFFAOYSA-N
MW219.28 g/mol
LogP1.61
Rot. Bonds3

About methyl 3-(3,4-dihydro-1H-isoquinolin-2-yl)propanoate

methyl 3-(3,4-dihydro-1H-isoquinolin-2-yl)propanoate (PubChem CID 10955041) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is methyl 3-(3,4-dihydro-1H-isoquinolin-2-yl)propanoate.

Molecular Properties

Compound Namemethyl 3-(3,4-dihydro-1H-isoquinolin-2-yl)propanoate
PubChem CID10955041
Molecular FormulaC13H17NO2
Molecular Weight219.28 g/mol
Exact Mass219.13
IUPAC Namemethyl 3-(3,4-dihydro-1H-isoquinolin-2-yl)propanoate
SMILESCOC(=O)CCN1CCc2ccccc2C1
InChIInChI=1S/C13H17NO2/c1-16-13(15)7-9-14-8-6-11-4-2-3-5-12(11)10-14/h2-5H,6-10H2,1H3
InChIKeyLGCHTHNCFDGWBW-UHFFFAOYSA-N
XLogP1.61
TPSA29.54 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500219.28
LogP ≤ 51.61
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 3-(3,4-dihydro-1H-isoquinolin-2-yl)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-(3,4-dihydro-1H-isoquinolin-2-yl)propanoate?
The IUPAC name of methyl 3-(3,4-dihydro-1H-isoquinolin-2-yl)propanoate (CID 10955041) is methyl 3-(3,4-dihydro-1H-isoquinolin-2-yl)propanoate.
What is the SMILES notation for methyl 3-(3,4-dihydro-1H-isoquinolin-2-yl)propanoate?
The canonical SMILES for methyl 3-(3,4-dihydro-1H-isoquinolin-2-yl)propanoate is COC(=O)CCN1CCc2ccccc2C1.
What is the InChIKey of methyl 3-(3,4-dihydro-1H-isoquinolin-2-yl)propanoate?
The InChIKey is LGCHTHNCFDGWBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO2/c1-16-13(15)7-9-14-8-6-11-4-2-3-5-12(11)10-14/h2-5H,6-10H2,1H3.
What are the key properties of methyl 3-(3,4-dihydro-1H-isoquinolin-2-yl)propanoate?
methyl 3-(3,4-dihydro-1H-isoquinolin-2-yl)propanoate has a molecular weight of 219.28 g/mol, XLogP of 1.61, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(3,4-dihydro-1H-isoquinolin-2-yl)propanoate is sourced from PubChem (CID 10955041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).