C13H19NO2 — CID 91290502
methyl acetate;2-methyl-3,4-dihydro-1H-isoquinoline (PubChem CID 91290502) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is methyl acetate;2-methyl-3,4-dihydro-1H-isoquinoline.
| Compound Name | methyl acetate;2-methyl-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 91290502 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | methyl acetate;2-methyl-3,4-dihydro-1H-isoquinoline |
| SMILES | CN1CCc2ccccc2C1.COC(C)=O |
| InChI | InChI=1S/C10H13N.C3H6O2/c1-11-7-6-9-4-2-3-5-10(9)8-11;1-3(4)5-2/h2-5H,6-8H2,1H3;1-2H3 |
| InChIKey | JXEYKFXATHKQTP-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |