About methanol;2-methyl-3,4-dihydro-1H-isoquinoline
methanol;2-methyl-3,4-dihydro-1H-isoquinoline (PubChem CID 142001874) has the molecular formula C11H17NO
and a molecular weight of 179.26 g/mol. Its IUPAC name is methanol;2-methyl-3,4-dihydro-1H-isoquinoline.
Molecular Properties
| Compound Name | methanol;2-methyl-3,4-dihydro-1H-isoquinoline |
| PubChem CID | 142001874 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | methanol;2-methyl-3,4-dihydro-1H-isoquinoline |
| SMILES | CN1CCc2ccccc2C1.CO |
| InChI | InChI=1S/C10H13N.CH4O/c1-11-7-6-9-4-2-3-5-10(9)8-11;1-2/h2-5H,6-8H2,1H3;2H,1H3 |
| InChIKey | WGFZDHJEFCPPOU-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methanol;2-methyl-3,4-dihydro-1H-isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanol;2-methyl-3,4-dihydro-1H-isoquinoline?
The IUPAC name of methanol;2-methyl-3,4-dihydro-1H-isoquinoline (CID 142001874) is methanol;2-methyl-3,4-dihydro-1H-isoquinoline.
What is the SMILES notation for methanol;2-methyl-3,4-dihydro-1H-isoquinoline?
The canonical SMILES for methanol;2-methyl-3,4-dihydro-1H-isoquinoline is CN1CCc2ccccc2C1.CO.
What is the InChIKey of methanol;2-methyl-3,4-dihydro-1H-isoquinoline?
The InChIKey is WGFZDHJEFCPPOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N.CH4O/c1-11-7-6-9-4-2-3-5-10(9)8-11;1-2/h2-5H,6-8H2,1H3;2H,1H3.
What are the key properties of methanol;2-methyl-3,4-dihydro-1H-isoquinoline?
methanol;2-methyl-3,4-dihydro-1H-isoquinoline has a molecular weight of 179.26 g/mol, XLogP of 1.28, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methanol;2-methyl-3,4-dihydro-1H-isoquinoline is sourced from PubChem (CID 142001874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).