C11H17NO — CID 142001874
methanol;2-methyl-3,4-dihydro-1H-isoquinoline (PubChem CID 142001874) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is methanol;2-methyl-3,4-dihydro-1H-isoquinoline.
| Compound Name | methanol;2-methyl-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 142001874 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | methanol;2-methyl-3,4-dihydro-1H-isoquinoline |
| SMILES | CN1CCc2ccccc2C1.CO |
| InChI | InChI=1S/C10H13N.CH4O/c1-11-7-6-9-4-2-3-5-10(9)8-11;1-2/h2-5H,6-8H2,1H3;2H,1H3 |
| InChIKey | WGFZDHJEFCPPOU-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |