C10H13N — CID 175786107
7-deuterio-2-methyl-3,4-dihydro-1H-isoquinoline (PubChem CID 175786107) has the molecular formula C10H13N and a molecular weight of 148.23 g/mol. Its IUPAC name is 7-deuterio-2-methyl-3,4-dihydro-1H-isoquinoline.
| Compound Name | 7-deuterio-2-methyl-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 175786107 |
| Molecular Formula | C10H13N |
| Molecular Weight | 148.23 g/mol |
| Exact Mass | 148.11 |
| IUPAC Name | 7-deuterio-2-methyl-3,4-dihydro-1H-isoquinoline |
| SMILES | [2H]c1ccc2c(c1)CN(C)CC2 |
| InChI | InChI=1S/C10H13N/c1-11-7-6-9-4-2-3-5-10(9)8-11/h2-5H,6-8H2,1H3/i3D |
| InChIKey | KYXSVGVQGFPNRQ-WFVSFCRTSA-N |
| XLogP | 1.67 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.23 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |