C10H13NO2S — CID 175981728
7-deuterio-2-methylsulfonyl-3,4-dihydro-1H-isoquinoline (PubChem CID 175981728) has the molecular formula C10H13NO2S and a molecular weight of 212.29 g/mol. Its IUPAC name is 7-deuterio-2-methylsulfonyl-3,4-dihydro-1H-isoquinoline.
| Compound Name | 7-deuterio-2-methylsulfonyl-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 175981728 |
| Molecular Formula | C10H13NO2S |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | 7-deuterio-2-methylsulfonyl-3,4-dihydro-1H-isoquinoline |
| SMILES | [2H]c1ccc2c(c1)CN(S(C)(=O)=O)CC2 |
| InChI | InChI=1S/C10H13NO2S/c1-14(12,13)11-7-6-9-4-2-3-5-10(9)8-11/h2-5H,6-8H2,1H3/i3D |
| InChIKey | FKKMAKWPSSRSFE-WFVSFCRTSA-N |
| XLogP | 1.00 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |