C12H17NO3S — CID 82175792
1-(2-methylsulfonyl-3,4-dihydro-1H-isoquinolin-7-yl)ethanol (PubChem CID 82175792) has the molecular formula C12H17NO3S and a molecular weight of 255.34 g/mol. Its IUPAC name is 1-(2-methylsulfonyl-3,4-dihydro-1H-isoquinolin-7-yl)ethanol.
| Compound Name | 1-(2-methylsulfonyl-3,4-dihydro-1H-isoquinolin-7-yl)ethanol |
|---|---|
| PubChem CID | 82175792 |
| Molecular Formula | C12H17NO3S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 1-(2-methylsulfonyl-3,4-dihydro-1H-isoquinolin-7-yl)ethanol |
| SMILES | CC(O)c1ccc2c(c1)CN(S(C)(=O)=O)CC2 |
| InChI | InChI=1S/C12H17NO3S/c1-9(14)11-4-3-10-5-6-13(17(2,15)16)8-12(10)7-11/h3-4,7,9,14H,5-6,8H2,1-2H3 |
| InChIKey | SJVVEXNPYPLNPZ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |