C10H14N2O2S — CID 162521919
7-methyl-3,4-dihydro-1H-isoquinoline-2-sulfonamide (PubChem CID 162521919) has the molecular formula C10H14N2O2S and a molecular weight of 226.30 g/mol. Its IUPAC name is 7-methyl-3,4-dihydro-1H-isoquinoline-2-sulfonamide.
| Compound Name | 7-methyl-3,4-dihydro-1H-isoquinoline-2-sulfonamide |
|---|---|
| PubChem CID | 162521919 |
| Molecular Formula | C10H14N2O2S |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 7-methyl-3,4-dihydro-1H-isoquinoline-2-sulfonamide |
| SMILES | Cc1ccc2c(c1)CN(S(N)(=O)=O)CC2 |
| InChI | InChI=1S/C10H14N2O2S/c1-8-2-3-9-4-5-12(15(11,13)14)7-10(9)6-8/h2-3,6H,4-5,7H2,1H3,(H2,11,13,14) |
| InChIKey | SMVBBFPJGXJNPL-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |