C10H14N2O2S2 — CID 155202858
6-methylsulfanyl-3,4-dihydro-1H-isoquinoline-2-sulfonamide (PubChem CID 155202858) has the molecular formula C10H14N2O2S2 and a molecular weight of 258.37 g/mol. Its IUPAC name is 6-methylsulfanyl-3,4-dihydro-1H-isoquinoline-2-sulfonamide.
| Compound Name | 6-methylsulfanyl-3,4-dihydro-1H-isoquinoline-2-sulfonamide |
|---|---|
| PubChem CID | 155202858 |
| Molecular Formula | C10H14N2O2S2 |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | 6-methylsulfanyl-3,4-dihydro-1H-isoquinoline-2-sulfonamide |
| SMILES | CSc1ccc2c(c1)CCN(S(N)(=O)=O)C2 |
| InChI | InChI=1S/C10H14N2O2S2/c1-15-10-3-2-9-7-12(16(11,13)14)5-4-8(9)6-10/h2-3,6H,4-5,7H2,1H3,(H2,11,13,14) |
| InChIKey | OAKZLIHSNWDFKD-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |