C11H13NOS — CID 142024980
1-(5-methylsulfanyl-1,3-dihydroisoindol-2-yl)ethanone (PubChem CID 142024980) has the molecular formula C11H13NOS and a molecular weight of 207.30 g/mol. Its IUPAC name is 1-(5-methylsulfanyl-1,3-dihydroisoindol-2-yl)ethanone.
| Compound Name | 1-(5-methylsulfanyl-1,3-dihydroisoindol-2-yl)ethanone |
|---|---|
| PubChem CID | 142024980 |
| Molecular Formula | C11H13NOS |
| Molecular Weight | 207.30 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | 1-(5-methylsulfanyl-1,3-dihydroisoindol-2-yl)ethanone |
| SMILES | CSc1ccc2c(c1)CN(C(C)=O)C2 |
| InChI | InChI=1S/C11H13NOS/c1-8(13)12-6-9-3-4-11(14-2)5-10(9)7-12/h3-5H,6-7H2,1-2H3 |
| InChIKey | STPLCWIBSSBKCP-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.30 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |