C11H17N3O4S2 — CID 110294126
2-N,2-N-dimethyl-3,4-dihydro-1H-isoquinoline-2,7-disulfonamide (PubChem CID 110294126) has the molecular formula C11H17N3O4S2 and a molecular weight of 319.41 g/mol. Its IUPAC name is 2-N,2-N-dimethyl-3,4-dihydro-1H-isoquinoline-2,7-disulfonamide.
| Compound Name | 2-N,2-N-dimethyl-3,4-dihydro-1H-isoquinoline-2,7-disulfonamide |
|---|---|
| PubChem CID | 110294126 |
| Molecular Formula | C11H17N3O4S2 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | 2-N,2-N-dimethyl-3,4-dihydro-1H-isoquinoline-2,7-disulfonamide |
| SMILES | CN(C)S(=O)(=O)N1CCc2ccc(S(N)(=O)=O)cc2C1 |
| InChI | InChI=1S/C11H17N3O4S2/c1-13(2)20(17,18)14-6-5-9-3-4-11(19(12,15)16)7-10(9)8-14/h3-4,7H,5-6,8H2,1-2H3,(H2,12,15,16) |
| InChIKey | UGZKZFAZBWWJCI-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |