C17H18N2O3S — CID 110294064
2-(4-methylbenzoyl)-3,4-dihydro-1H-isoquinoline-7-sulfonamide (PubChem CID 110294064) has the molecular formula C17H18N2O3S and a molecular weight of 330.41 g/mol. Its IUPAC name is 2-(4-methylbenzoyl)-3,4-dihydro-1H-isoquinoline-7-sulfonamide.
| Compound Name | 2-(4-methylbenzoyl)-3,4-dihydro-1H-isoquinoline-7-sulfonamide |
|---|---|
| PubChem CID | 110294064 |
| Molecular Formula | C17H18N2O3S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 2-(4-methylbenzoyl)-3,4-dihydro-1H-isoquinoline-7-sulfonamide |
| SMILES | Cc1ccc(C(=O)N2CCc3ccc(S(N)(=O)=O)cc3C2)cc1 |
| InChI | InChI=1S/C17H18N2O3S/c1-12-2-4-14(5-3-12)17(20)19-9-8-13-6-7-16(23(18,21)22)10-15(13)11-19/h2-7,10H,8-9,11H2,1H3,(H2,18,21,22) |
| InChIKey | PXZBMROZPWIOFP-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |