C14H14N2O4S — CID 110294059
2-(furan-2-carbonyl)-3,4-dihydro-1H-isoquinoline-7-sulfonamide (PubChem CID 110294059) has the molecular formula C14H14N2O4S and a molecular weight of 306.34 g/mol. Its IUPAC name is 2-(furan-2-carbonyl)-3,4-dihydro-1H-isoquinoline-7-sulfonamide.
| Compound Name | 2-(furan-2-carbonyl)-3,4-dihydro-1H-isoquinoline-7-sulfonamide |
|---|---|
| PubChem CID | 110294059 |
| Molecular Formula | C14H14N2O4S |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 2-(furan-2-carbonyl)-3,4-dihydro-1H-isoquinoline-7-sulfonamide |
| SMILES | NS(=O)(=O)c1ccc2c(c1)CN(C(=O)c1ccco1)CC2 |
| InChI | InChI=1S/C14H14N2O4S/c15-21(18,19)12-4-3-10-5-6-16(9-11(10)8-12)14(17)13-2-1-7-20-13/h1-4,7-8H,5-6,9H2,(H2,15,18,19) |
| InChIKey | SJGGFUZGVJKLFB-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 93.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |