C16H18N2O4S — CID 110310919
2-[3-(furan-2-yl)propanoyl]-3,4-dihydro-1H-isoquinoline-7-sulfonamide (PubChem CID 110310919) has the molecular formula C16H18N2O4S and a molecular weight of 334.40 g/mol. Its IUPAC name is 2-[3-(furan-2-yl)propanoyl]-3,4-dihydro-1H-isoquinoline-7-sulfonamide.
| Compound Name | 2-[3-(furan-2-yl)propanoyl]-3,4-dihydro-1H-isoquinoline-7-sulfonamide |
|---|---|
| PubChem CID | 110310919 |
| Molecular Formula | C16H18N2O4S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | 2-[3-(furan-2-yl)propanoyl]-3,4-dihydro-1H-isoquinoline-7-sulfonamide |
| SMILES | NS(=O)(=O)c1ccc2c(c1)CN(C(=O)CCc1ccco1)CC2 |
| InChI | InChI=1S/C16H18N2O4S/c17-23(20,21)15-5-3-12-7-8-18(11-13(12)10-15)16(19)6-4-14-2-1-9-22-14/h1-3,5,9-10H,4,6-8,11H2,(H2,17,20,21) |
| InChIKey | JXOOFKWPERLDID-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 93.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |