C19H22N2O4S — CID 110294085
2-[2-(4-ethoxyphenyl)acetyl]-3,4-dihydro-1H-isoquinoline-7-sulfonamide (PubChem CID 110294085) has the molecular formula C19H22N2O4S and a molecular weight of 374.46 g/mol. Its IUPAC name is 2-[2-(4-ethoxyphenyl)acetyl]-3,4-dihydro-1H-isoquinoline-7-sulfonamide.
| Compound Name | 2-[2-(4-ethoxyphenyl)acetyl]-3,4-dihydro-1H-isoquinoline-7-sulfonamide |
|---|---|
| PubChem CID | 110294085 |
| Molecular Formula | C19H22N2O4S |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 2-[2-(4-ethoxyphenyl)acetyl]-3,4-dihydro-1H-isoquinoline-7-sulfonamide |
| SMILES | CCOc1ccc(CC(=O)N2CCc3ccc(S(N)(=O)=O)cc3C2)cc1 |
| InChI | InChI=1S/C19H22N2O4S/c1-2-25-17-6-3-14(4-7-17)11-19(22)21-10-9-15-5-8-18(26(20,23)24)12-16(15)13-21/h3-8,12H,2,9-11,13H2,1H3,(H2,20,23,24) |
| InChIKey | YSIVGKZHWNYWJR-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |