C14H21N3O3S — CID 110632531
N-butan-2-yl-7-sulfamoyl-3,4-dihydro-1H-isoquinoline-2-carboxamide (PubChem CID 110632531) has the molecular formula C14H21N3O3S and a molecular weight of 311.41 g/mol. Its IUPAC name is N-butan-2-yl-7-sulfamoyl-3,4-dihydro-1H-isoquinoline-2-carboxamide.
| Compound Name | N-butan-2-yl-7-sulfamoyl-3,4-dihydro-1H-isoquinoline-2-carboxamide |
|---|---|
| PubChem CID | 110632531 |
| Molecular Formula | C14H21N3O3S |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | N-butan-2-yl-7-sulfamoyl-3,4-dihydro-1H-isoquinoline-2-carboxamide |
| SMILES | CCC(C)NC(=O)N1CCc2ccc(S(N)(=O)=O)cc2C1 |
| InChI | InChI=1S/C14H21N3O3S/c1-3-10(2)16-14(18)17-7-6-11-4-5-13(21(15,19)20)8-12(11)9-17/h4-5,8,10H,3,6-7,9H2,1-2H3,(H,16,18)(H2,15,19,20) |
| InChIKey | PUXHNPSTYIBUAZ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |