C9H10N2O4S — CID 71089634
5-sulfamoyl-1,3-dihydroisoindole-2-carboxylic acid (PubChem CID 71089634) has the molecular formula C9H10N2O4S and a molecular weight of 242.26 g/mol. Its IUPAC name is 5-sulfamoyl-1,3-dihydroisoindole-2-carboxylic acid.
| Compound Name | 5-sulfamoyl-1,3-dihydroisoindole-2-carboxylic acid |
|---|---|
| PubChem CID | 71089634 |
| Molecular Formula | C9H10N2O4S |
| Molecular Weight | 242.26 g/mol |
| Exact Mass | 242.04 |
| IUPAC Name | 5-sulfamoyl-1,3-dihydroisoindole-2-carboxylic acid |
| SMILES | NS(=O)(=O)c1ccc2c(c1)CN(C(=O)O)C2 |
| InChI | InChI=1S/C9H10N2O4S/c10-16(14,15)8-2-1-6-4-11(9(12)13)5-7(6)3-8/h1-3H,4-5H2,(H,12,13)(H2,10,14,15) |
| InChIKey | VAKKUTRSQFHQBX-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.26 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |