C17H19N3O3S — CID 110354899
N-benzyl-7-sulfamoyl-3,4-dihydro-1H-isoquinoline-2-carboxamide (PubChem CID 110354899) has the molecular formula C17H19N3O3S and a molecular weight of 345.42 g/mol. Its IUPAC name is N-benzyl-7-sulfamoyl-3,4-dihydro-1H-isoquinoline-2-carboxamide.
| Compound Name | N-benzyl-7-sulfamoyl-3,4-dihydro-1H-isoquinoline-2-carboxamide |
|---|---|
| PubChem CID | 110354899 |
| Molecular Formula | C17H19N3O3S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | N-benzyl-7-sulfamoyl-3,4-dihydro-1H-isoquinoline-2-carboxamide |
| SMILES | NS(=O)(=O)c1ccc2c(c1)CN(C(=O)NCc1ccccc1)CC2 |
| InChI | InChI=1S/C17H19N3O3S/c18-24(22,23)16-7-6-14-8-9-20(12-15(14)10-16)17(21)19-11-13-4-2-1-3-5-13/h1-7,10H,8-9,11-12H2,(H,19,21)(H2,18,22,23) |
| InChIKey | HGLQVYVPMKHRRA-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |