C18H23IN4O2S — CID 110946623
N'-methyl-N-[(3-sulfamoylphenyl)methyl]-3,4-dihydro-1H-isoquinoline-2-carboximidamide;hydroiodide (PubChem CID 110946623) has the molecular formula C18H23IN4O2S and a molecular weight of 486.38 g/mol. Its IUPAC name is N'-methyl-N-[(3-sulfamoylphenyl)methyl]-3,4-dihydro-1H-isoquinoline-2-carboximidamide;hydroiodide.
| Compound Name | N'-methyl-N-[(3-sulfamoylphenyl)methyl]-3,4-dihydro-1H-isoquinoline-2-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 110946623 |
| Molecular Formula | C18H23IN4O2S |
| Molecular Weight | 486.38 g/mol |
| Exact Mass | 486.06 |
| IUPAC Name | N'-methyl-N-[(3-sulfamoylphenyl)methyl]-3,4-dihydro-1H-isoquinoline-2-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCc1cccc(S(N)(=O)=O)c1)N1CCc2ccccc2C1.I |
| InChI | InChI=1S/C18H22N4O2S.HI/c1-20-18(22-10-9-15-6-2-3-7-16(15)13-22)21-12-14-5-4-8-17(11-14)25(19,23)24;/h2-8,11H,9-10,12-13H2,1H3,(H,20,21)(H2,19,23,24);1H |
| InChIKey | KDYSEYIKYOZWMF-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.38 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|