C20H28IN5O3S — CID 111133200
4-(2-methoxyphenyl)-N'-methyl-N-[(3-sulfamoylphenyl)methyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 111133200) has the molecular formula C20H28IN5O3S and a molecular weight of 545.45 g/mol. Its IUPAC name is 4-(2-methoxyphenyl)-N'-methyl-N-[(3-sulfamoylphenyl)methyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-(2-methoxyphenyl)-N'-methyl-N-[(3-sulfamoylphenyl)methyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111133200 |
| Molecular Formula | C20H28IN5O3S |
| Molecular Weight | 545.45 g/mol |
| Exact Mass | 545.10 |
| IUPAC Name | 4-(2-methoxyphenyl)-N'-methyl-N-[(3-sulfamoylphenyl)methyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCc1cccc(S(N)(=O)=O)c1)N1CCN(c2ccccc2OC)CC1.I |
| InChI | InChI=1S/C20H27N5O3S.HI/c1-22-20(23-15-16-6-5-7-17(14-16)29(21,26)27)25-12-10-24(11-13-25)18-8-3-4-9-19(18)28-2;/h3-9,14H,10-13,15H2,1-2H3,(H,22,23)(H2,21,26,27);1H |
| InChIKey | CZAOXBMHIFHYNK-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 100.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.45 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|