C23H29N7O — CID 111133871
4-(2-methoxyphenyl)-N'-methyl-N-[[3-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]piperazine-1-carboximidamide (PubChem CID 111133871) has the molecular formula C23H29N7O and a molecular weight of 419.53 g/mol. Its IUPAC name is 4-(2-methoxyphenyl)-N'-methyl-N-[[3-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]piperazine-1-carboximidamide.
| Compound Name | 4-(2-methoxyphenyl)-N'-methyl-N-[[3-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111133871 |
| Molecular Formula | C23H29N7O |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.24 |
| IUPAC Name | 4-(2-methoxyphenyl)-N'-methyl-N-[[3-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCc1cccc(Cn2cncn2)c1)N1CCN(c2ccccc2OC)CC1 |
| InChI | InChI=1S/C23H29N7O/c1-24-23(26-15-19-6-5-7-20(14-19)16-30-18-25-17-27-30)29-12-10-28(11-13-29)21-8-3-4-9-22(21)31-2/h3-9,14,17-18H,10-13,15-16H2,1-2H3,(H,24,26) |
| InChIKey | WPJRJCVBCCMBIC-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 70.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|