C24H31N7O — CID 111133537
N-ethyl-4-(2-methoxyphenyl)-N'-[[3-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]piperazine-1-carboximidamide (PubChem CID 111133537) has the molecular formula C24H31N7O and a molecular weight of 433.56 g/mol. Its IUPAC name is N-ethyl-4-(2-methoxyphenyl)-N'-[[3-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]piperazine-1-carboximidamide.
| Compound Name | N-ethyl-4-(2-methoxyphenyl)-N'-[[3-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111133537 |
| Molecular Formula | C24H31N7O |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.26 |
| IUPAC Name | N-ethyl-4-(2-methoxyphenyl)-N'-[[3-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1cccc(Cn2cncn2)c1)N1CCN(c2ccccc2OC)CC1 |
| InChI | InChI=1S/C24H31N7O/c1-3-26-24(27-16-20-7-6-8-21(15-20)17-31-19-25-18-28-31)30-13-11-29(12-14-30)22-9-4-5-10-23(22)32-2/h4-10,15,18-19H,3,11-14,16-17H2,1-2H3,(H,26,27) |
| InChIKey | QCRDIHCDUHDVAM-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 70.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|