C22H30IN5O2 — CID 111132638
3-[[[ethylamino-[4-(2-methoxyphenyl)piperazin-1-yl]methylidene]amino]methyl]benzamide;hydroiodide (PubChem CID 111132638) has the molecular formula C22H30IN5O2 and a molecular weight of 523.42 g/mol. Its IUPAC name is 3-[[[ethylamino-[4-(2-methoxyphenyl)piperazin-1-yl]methylidene]amino]methyl]benzamide;hydroiodide.
| Compound Name | 3-[[[ethylamino-[4-(2-methoxyphenyl)piperazin-1-yl]methylidene]amino]methyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 111132638 |
| Molecular Formula | C22H30IN5O2 |
| Molecular Weight | 523.42 g/mol |
| Exact Mass | 523.14 |
| IUPAC Name | 3-[[[ethylamino-[4-(2-methoxyphenyl)piperazin-1-yl]methylidene]amino]methyl]benzamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(C(N)=O)c1)N1CCN(c2ccccc2OC)CC1.I |
| InChI | InChI=1S/C22H29N5O2.HI/c1-3-24-22(25-16-17-7-6-8-18(15-17)21(23)28)27-13-11-26(12-14-27)19-9-4-5-10-20(19)29-2;/h4-10,15H,3,11-14,16H2,1-2H3,(H2,23,28)(H,24,25);1H |
| InChIKey | SHAQJMVIRYHQNP-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 83.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.42 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|