C21H30IN5O3S — CID 111132918
N-ethyl-4-(2-methoxyphenyl)-N'-[(4-sulfamoylphenyl)methyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 111132918) has the molecular formula C21H30IN5O3S and a molecular weight of 559.47 g/mol. Its IUPAC name is N-ethyl-4-(2-methoxyphenyl)-N'-[(4-sulfamoylphenyl)methyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-4-(2-methoxyphenyl)-N'-[(4-sulfamoylphenyl)methyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111132918 |
| Molecular Formula | C21H30IN5O3S |
| Molecular Weight | 559.47 g/mol |
| Exact Mass | 559.11 |
| IUPAC Name | N-ethyl-4-(2-methoxyphenyl)-N'-[(4-sulfamoylphenyl)methyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(S(N)(=O)=O)cc1)N1CCN(c2ccccc2OC)CC1.I |
| InChI | InChI=1S/C21H29N5O3S.HI/c1-3-23-21(24-16-17-8-10-18(11-9-17)30(22,27)28)26-14-12-25(13-15-26)19-6-4-5-7-20(19)29-2;/h4-11H,3,12-16H2,1-2H3,(H,23,24)(H2,22,27,28);1H |
| InChIKey | AYBDVDFAQNSWCL-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 100.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.47 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|