C16H26IN5O3S — CID 110962972
4-acetyl-N-ethyl-N'-[(4-sulfamoylphenyl)methyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 110962972) has the molecular formula C16H26IN5O3S and a molecular weight of 495.39 g/mol. Its IUPAC name is 4-acetyl-N-ethyl-N'-[(4-sulfamoylphenyl)methyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-acetyl-N-ethyl-N'-[(4-sulfamoylphenyl)methyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 110962972 |
| Molecular Formula | C16H26IN5O3S |
| Molecular Weight | 495.39 g/mol |
| Exact Mass | 495.08 |
| IUPAC Name | 4-acetyl-N-ethyl-N'-[(4-sulfamoylphenyl)methyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(S(N)(=O)=O)cc1)N1CCN(C(C)=O)CC1.I |
| InChI | InChI=1S/C16H25N5O3S.HI/c1-3-18-16(21-10-8-20(9-11-21)13(2)22)19-12-14-4-6-15(7-5-14)25(17,23)24;/h4-7H,3,8-12H2,1-2H3,(H,18,19)(H2,17,23,24);1H |
| InChIKey | AHTZEXNRFKSHBY-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 108.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.39 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|